| Name | Trimellitic anhydride acid chloride |
| Synonyms | 4-Chloroformylphthalic anhydride Anhydrotrimellitic acid chloride Trimellitic anhydride acid chloride 4-(Chlorocarbonyl)phthalic anhydride 1,3-Benzofurandione-5-carbonyl chloride 4-(Chlorocarboxy)benzenedicarboxylic anhydride 1,3-dihydro-1,3-dioxo-5-isobenzofurancarbonylchlorid 1,3-Dioxo-1,3-dihydro-2-benzofuran-5-carbonyl chloride 5-Isobenzofurancarbonyl chloride, 1,3-dihydro-1,3-dioxo- |
| CAS | 1204-28-0 |
| EINECS | 214-874-8 |
| InChI | InChI=1/C18H10O11.ClH/c19-13(20)7-1-3-9(11(5-7)15(23)24)17(27)29-18(28)10-4-2-8(14(21)22)6-12(10)16(25)26;/h1-6H,(H,19,20)(H,21,22)(H,23,24)(H,25,26);1H/p-1 |
| InChIKey | NJMOHBDCGXJLNJ-UHFFFAOYSA-N |
| Molecular Formula | C9H3ClO4 |
| Molar Mass | 210.57 |
| Density | 1.5015 (rough estimate) |
| Melting Point | 66-69℃ |
| Boling Point | 302.37°C (rough estimate) |
| Water Solubility | decomposes |
| Appearance | White crystal |
| Storage Condition | 2-8°C |
| Sensitive | Easily absorbing moisture |
| Refractive Index | 1.4571 (estimate) |
| MDL | MFCD00005924 |
| Hazard Symbols | C - Corrosive![]() |
| Risk Codes | R29 - Contact with water liberates toxic gas R34 - Causes burns |
| Safety Description | S26 - In case of contact with eyes, rinse immediately with plenty of water and seek medical advice. S36/37/39 - Wear suitable protective clothing, gloves and eye/face protection. S45 - In case of accident or if you feel unwell, seek medical advice immediately (show the label whenever possible.) |
| UN IDs | UN 3261 |
| WGK Germany | 3 |
| FLUKA BRAND F CODES | 10-21 |
| TSCA | Yes |
| HS Code | 29173990 |
| Hazard Class | 8 |
| Packing Group | II |
| Reference Show more | 1. [IF=4.932] Huawei Zhao et al.Azithromycin pretreatment exacerbates atopic dermatitis in trimellitic anhydride-induced model mice accompanied by correlated changes in the gut microbiota and serum cytokines.Int Immunopharmacol. 2021 Nov;:108388 |
| storage conditions | 2-8°C |
| water solubility | decomposes |
| sensitivity | Moisture Sensitive |
| BRN | 610823 |
| InChIKey | NJMOHBDCGXJLNJ-UHFFFAOYSA-N |
| NIST chemical information | Phthalic , 4-(chloroformyl)-,anhydride(1204-28-0) |
| EPA chemical information | 5-Isobenzofurancarbonyl chloride, 1,3-dihydro-1,3-dioxo- (1204-28-0) |